
Catalog Number	AR00EMDF
Chemical Name	4-(Bromomethyl)-4'-(trifluoromethyl)-1,1'-biphenyl
CAS Number	613241-14-8
Molecular Formula	C14H10BrF3
Molecular Weight	315.1284
MDL Number	MFCD25460278
SMILES	BrCc1ccc(cc1)c1ccc(cc1)C(F)(F)F

4-(bromomethyl)-4'-(trifluoromethyl)-1,1'-biphenyl is a versatile chemical compound that finds extensive utility in chemical synthesis procedures. Its unique molecular structure, characterized by the presence of both bromomethyl and trifluoromethyl groups, provides various opportunities for functional group transformations and diversification in organic reactions. In the realm of chemical synthesis, this compound acts as a valuable building block for constructing complex organic molecules with specific properties. The bromine atom facilitates nucleophilic substitution reactions, enabling the introduction of various functional groups at the site of bromination. On the other hand, the trifluoromethyl group exhibits electron-withdrawing characteristics, influencing the reactivity and selectivity of the compound in transformations involving aromatic systems. When incorporated into synthetic routes, 4-(bromomethyl)-4'-(trifluoromethyl)-1,1'-biphenyl enables the efficient synthesis of biologically active compounds, pharmaceutical intermediates, agrochemicals, and materials with tailored properties. Its strategic placement within the molecular framework offers control over the regioselectivity and stereochemistry of the ensuing chemical transformations, leading to the formation of complex molecular architectures with high precision. With its versatile reactivity profile and structural features, this compound serves as a valuable tool for synthetic chemists seeking to access novel and diverse chemical structures for various applications.