
Catalog Number	AR00EA28
Chemical Name	TRIPHENYL-(3,4,5-TRIMETHOXY-BENZYL)-PHOSPHONIUM, BROMIDE
CAS Number	61240-20-8
Molecular Formula	C28H28BrO3P
Molecular Weight	523.3979
MDL Number	MFCD03452736
SMILES	COc1cc(cc(c1OC)OC)C[P+](c1ccccc1)(c1ccccc1)c1ccccc1.[Br-]

Phosphonium, triphenyl[(3,4,5-trimethoxyphenyl)methyl]-, bromide (1:1) is a powerful reagent widely used in chemical synthesis. It serves as a key component in various reactions due to its unique properties. This compound is particularly valuable in organic synthesis processes where the introduction of the triphenylphosphonium group is required. It can act as a strong nucleophile in substitution reactions, facilitating the formation of new chemical bonds.In organic chemistry, Phosphonium, triphenyl[(3,4,5-trimethoxyphenyl)methyl]-, bromide (1:1) is commonly utilized in the preparation of complex molecules, such as natural products or pharmaceutical intermediates. Its reactivity allows for the efficient construction of intricate molecular structures with high selectivity. Additionally, this reagent is known to exhibit good stability under various reaction conditions, making it a reliable choice for synthetic chemists.Furthermore, Phosphonium, triphenyl[(3,4,5-trimethoxyphenyl)methyl]-, bromide (1:1) plays a crucial role in the creation of functionalized compounds with enhanced properties. By incorporating this reagent into chemical reactions, researchers can access a wide range of derivatives that may possess improved biological activity or material characteristics. Its versatility and efficiency make it a valuable tool in the toolbox of synthetic chemists seeking to design novel molecules with tailored properties.