
Catalog Number	AR01K1LH
Chemical Name	2-Nitronicotinamide
CAS Number	60780-22-5
Molecular Formula	C6H5N3O3
Molecular Weight	167.1222
MDL Number	MFCD28363427
SMILES	[O-][N+](=O)c1ncccc1C(=O)N

2-Nitronicotinamide is a versatile compound used in chemical synthesis as a valuable building block for various organic reactions. With its unique molecular structure, 2-Nitronicotinamide serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and other fine chemicals. This compound is particularly prized for its ability to participate in important transformations, such as Nitro-Mannich reactions and metal-catalyzed cross-coupling reactions, leading to the formation of complex molecules with high levels of efficiency and selectivity. Additionally, 2-Nitronicotinamide is known for its compatibility with a wide range of functional groups, making it a valuable tool for chemists seeking to access diverse chemical space in their synthetic endeavors. By incorporating 2-Nitronicotinamide into their reactions, researchers can expedite the synthesis of novel compounds and streamline their synthetic pathways, ultimately advancing the field of organic chemistry.