
Catalog Number	AR00ESPZ
Chemical Name	cis-3-Acetoxy-5-hydroxycyclopent-1-ene
CAS Number	60410-18-6
Molecular Formula	C14H20O6
Molecular Weight	284.30500000000006
MDL Number	MFCD00077637
SMILES	CC(=O)O[C@H]1C[C@H](C=C1)O.CC(=O)O[C@@H]1C[C@@H](C=C1)O

The 4-Cyclopentene-1,3-diol, 1-acetate, (1R,3S)-rel- is a versatile compound that plays a crucial role in chemical synthesis. Due to its unique structure and stereochemistry, this compound serves as a valuable building block in the creation of various organic molecules. In organic synthesis, 4-Cyclopentene-1,3-diol, 1-acetate, (1R,3S)-rel- can be utilized as a key intermediate in the construction of complex natural products and pharmaceutical compounds. Its cyclopentene ring provides a scaffold for the attachment of different functional groups, allowing for the strategic manipulation of the molecule to introduce specific chemical functionalities at precise positions.Furthermore, the (1R,3S) stereochemistry of this compound is significant in determining its reactivity and selectivity in chemical reactions. The stereochemical configuration influences the interactions of the compound with other molecules, influencing the outcome of reactions and leading to desired stereochemical outcomes in the synthesis of target molecules.Overall, the 4-Cyclopentene-1,3-diol, 1-acetate, (1R,3S)-rel- compound is a valuable tool for chemists engaged in organic synthesis, offering opportunities for the construction of structurally diverse and challenging molecules with high stereochemical control.