
Catalog Number	AR00EHLB
Chemical Name	(+)-Normacusine B
CAS Number	604-99-9
Molecular Formula	C19H22N2O
Molecular Weight	294.3908
MDL Number	MFCD20260686
SMILES	C/C=C1/CN2[C@@H]3[C@@H](C1C[C@H]2c1c(C3)c2c([nH]1)cccc2)CO

Tombozine is a versatile chemical compound that finds wide application in chemical synthesis. As a potent catalyst, Tombozine facilitates various reactions by accelerating the conversion of starting materials into desired products in a more efficient and selective manner. Its unique structure and reactivity make it particularly useful in promoting complex transformations with high yields and minimal byproducts, making it a valuable tool for organic chemists. In addition to its catalytic properties, Tombozine can also act as a key building block in the synthesis of more complex molecules, enabling the creation of novel compounds with diverse functionalities. Overall, Tombozine plays a crucial role in advancing the field of chemical synthesis by enabling the synthesis of valuable products with improved efficiency and precision.