
Catalog Number	AR00E9RH
Chemical Name	(-)-10-(3-[DIMETHYLAMINO]-2-METHYLPROPYL)-2-METHOXY-PHENOTHIAZINE MALEATE SALT
CAS Number	60-99-1
Molecular Formula	C19H36N2OS
Molecular Weight	340.5669
MDL Number	MFCD00869255
SMILES	COC1CCC2C(C1)N(C[C@@H](CN(C)C)C)C1C(S2)CCCC1

Levomepromazine, also known as methotrimeprazine, is a phenothiazine derivative that is widely utilized in chemical synthesis as a versatile building block. This compound has a unique structure that makes it valuable in various synthetic pathways, particularly in the production of pharmaceuticals and fine chemicals. One key application of Levomepromazine in chemical synthesis is its role as a precursor in the synthesis of novel drug candidates. Its functional groups and reactivity allow for the introduction of diverse chemical functionalities, enabling the modification of its structure to generate new and potent compounds with potential therapeutic benefits. Additionally, Levomepromazine can also serve as a valuable intermediate in the synthesis of complex molecules due to its stability and compatibility with a wide range of synthetic conditions. Its ability to undergo various chemical transformations makes it a valuable tool for chemists seeking to develop novel compounds with enhanced properties.