
Catalog Number	AR003F4J
Chemical Name	1-Iodo-2,4-dimethyl-6-nitrobenzene
CAS Number	593255-20-0
Molecular Formula	C8H8INO2
Molecular Weight	277.05908999999997
MDL Number	MFCD19704776
SMILES	Cc1cc(C)c(c(c1)[N+](=O)[O-])I

1-Iodo-2,4-dimethyl-6-nitrobenzene is a versatile compound widely used in chemical synthesis for its unique reactivity and structural properties. This compound serves as a valuable building block in the creation of various organic molecules due to its substituted benzene ring with a nitro and iodo group. In chemical synthesis, 1-Iodo-2,4-dimethyl-6-nitrobenzene is often employed as a electrophilic aromatic substitution reactant. It undergoes reactions with a range of nucleophiles to introduce different functional groups onto the benzene ring, allowing for the selective modification of molecules. Additionally, the iodo group can serve as a handle for further transformations, such as palladium-catalyzed cross-coupling reactions, enabling the synthesis of more complex organic compounds.Furthermore, the presence of the nitro group can facilitate diverse transformations, including reduction to amino groups or conversion to other functional groups, thereby expanding the compound's synthetic utility. Overall, the strategic placement of substituents in 1-Iodo-2,4-dimethyl-6-nitrobenzene makes it a valuable and versatile tool for chemical synthesis applications, enabling the creation of a wide range of tailored organic molecules.