
Catalog Number	AR00EKWD
Chemical Name	4,8-Dimethoxyfuro[2,3-b]quinolin-7-ol
CAS Number	5876-17-5
Molecular Formula	C13H11NO4
Molecular Weight	245.2307
MDL Number	MFCD00582423
SMILES	COc1c(O)ccc2c1nc1occc1c2OC

Haplopine, a natural compound found in certain plant species, plays a significant role in chemical synthesis as a versatile building block. Its unique structure and reactivity make it a valuable tool in the creation of diverse organic molecules through various synthetic strategies. In the realm of organic chemistry, Haplopine serves as a precursor for the synthesis of complex molecules with potential pharmaceutical, agrochemical, and material science applications. By harnessing its reactivity, chemists can exploit Haplopine to introduce specific functional groups or stereochemical motifs into target molecules, allowing for the synthesis of novel compounds with tailored properties and activities. Furthermore, the use of Haplopine in chemical synthesis enables the development of more efficient and sustainable synthetic routes, contributing to the advancement of modern chemistry and its applications in various fields.