
Catalog Number	AR00EMAC
Chemical Name	2,6,14-triaminotriptycene
CAS Number	58519-06-5
Molecular Formula	C20H17N3
Molecular Weight	299.3691
SMILES	Nc1ccc2c(c1)C1c3c(C2c2c1ccc(c2)N)cc(cc3)N

9,10[1,2]-Benzenoanthracene-2,6,14-triamine, 9,10-dihydro- is a versatile compound commonly used in chemical synthesis for its unique properties. This compound serves as an important building block in the creation of organic molecules with intricate structures. Its reactive amine groups make it an ideal candidate for derivatization, allowing for the attachment of various functional groups to tailor its properties for specific applications. Researchers utilize this compound in the development of novel materials, pharmaceuticals, and organic electronics due to its ability to participate in a wide range of chemical reactions, leading to the formation of complex molecular frameworks.