
Catalog Number	AR00EM8X
Chemical Name	1-CYCLOPROPYL-1-(4-TRIFLUOROMETHYLPHENYL)METHYLAMINE
CAS Number	581812-93-3
Molecular Formula	C11H12F3N
Molecular Weight	215.2149
MDL Number	MFCD11848970
SMILES	NC(c1ccc(cc1)C(F)(F)F)C1CC1

Cyclopropyl(4-(trifluoromethyl)phenyl)methanamine, also known as $name$, serves as a versatile building block in chemical synthesis. With its unique structural properties and functional groups, this compound is utilized in various synthetic pathways to access complex organic molecules. In particular, $name$ is commonly employed as a key intermediate in the synthesis of pharmaceutical compounds, agrochemicals, and specialty materials. Its cyclopropyl ring imparts rigidity and stereochemical control to the molecules it is incorporated into, allowing for precise manipulation of molecular architecture. The trifluoromethyl group enhances the compound's lipophilicity and electronic properties, which can lead to improved pharmacological profiles and reactivity in synthetic transformations. Through strategic incorporation of $name$ into synthesis routes, chemists are able to efficiently access structurally diverse and biologically relevant compounds for a range of applications in the field of medicinal chemistry and materials science.