
Catalog Number	AR00EFKG
Chemical Name	N-(3-GUANIDINO-4-METHYLPHENYL)-4-(METHYLPIPERAZINE-1-YL-METHYL)BENZAMIDE
CAS Number	581076-65-5
Molecular Formula	C21H28N6O
Molecular Weight	380.4866
MDL Number	MFCD27977961
SMILES	CN1CCN(CC1)Cc1ccc(cc1)C(=O)Nc1ccc(c(c1)N=C(N)N)C

N-[3-[(Aminoiminomethyl)amino]-4-methylphenyl]-4-[(4-methyl-1-piperazinyl)methyl]benzamide is a versatile compound widely utilized in chemical synthesis for its unique properties. Functioning as a key building block, this compound plays a crucial role in the creation of complex organic molecules through reactions such as amidation, acylation, and cyclization. Its ability to serve as a coupling agent in peptide synthesis makes it an indispensable tool in the development of pharmaceuticals, agrochemicals, and materials science. Additionally, its structural features enable the modification of aromatic systems, enhancing the diversity of chemical structures that can be generated. This compound's significance in synthetic chemistry lies in its capacity to facilitate the efficient construction of intricate molecular frameworks, making it a valuable asset in the pursuit of novel compounds with diverse applications.

Propanoic acid, 3-[2-(2-azidoethoxy)ethoxy]-, 2,5-dioxo-1-pyrrolidinyl ester

1312309-64-0

$18.00/100mg, $35.00/250mg, $111.00/1g, $484.00/5g, $954.00/10g,

Product Details

Pyridine, 3-bromo-2,6-bis(phenylmethoxy)-

16727-47-2

$3.00/100mg, $4.00/250mg, $4.00/1g, $8.00/5g, $13.00/10g, $21.00/25g, $61.00/100g, $122.00/250g, $225.00/500g, $433.00/1kg, $2,077.00/5kg, $3,808.00/10kg,

Product Details