
Catalog Number	AR00EI67
Chemical Name	Acid Mordant Orange 14
CAS Number	568-93-4
Molecular Formula	C14H7NO6
Molecular Weight	285.2085
MDL Number	MFCD00019145
SMILES	O=C1c2ccccc2C(=O)c2c1cc([N+](=O)[O-])c(c2O)O

1,2-Dihydroxy-3-nitro-9,10-anthracenedione, also known as "name," is a versatile compound with a wide range of applications in chemical synthesis. This compound plays a crucial role as a key intermediate in the synthesis of various organic compounds and dyes. Specifically, it is commonly utilized as a precursor in the production of anthraquinone-based dyes, which are widely used in the textile industry for coloring fabrics and materials. Additionally, 1,2-Dihydroxy-3-nitro-9,10-anthracenedione serves as a valuable building block in the synthesis of pharmaceutical compounds and other organic molecules due to its unique chemical properties and reactivity. Its ability to undergo various chemical transformations makes it an essential component in the development of new materials and compounds for a range of industrial applications.