
Catalog Number	AR00EG8J
Chemical Name	METHYL 2,5-DICHLOROBENZOYLACETATE
CAS Number	56719-68-7
Molecular Formula	C10H8Cl2O3
Molecular Weight	247.0747
MDL Number	MFCD07778433
SMILES	COC(=O)CC(=O)c1cc(Cl)ccc1Cl

Methyl 2,5-dichloro-β-oxobenzenepropanoate is a versatile compound that finds application in chemical synthesis, particularly in the field of pharmaceuticals and agrochemicals. Its unique structure containing chlorine atoms and a β-keto ester moiety makes it a valuable building block for the synthesis of complex organic molecules. This compound can undergo various chemical reactions such as nucleophilic substitution, aldol condensation, and ester hydrolysis, allowing for the design and creation of new compounds with diverse properties and functionalities. In addition, Methyl 2,5-dichloro-β-oxobenzenepropanoate can serve as a precursor for the synthesis of bioactive compounds with potential applications in drug discovery and agricultural chemistry. Its versatility and reactivity make it a valuable tool for chemists and researchers in developing novel compounds for various industrial purposes.