
Catalog Number	AR00ECPD
Chemical Name	5-BETA-CHOLANIC ACID-7-ALPHA, 12-ALPHA-DIOL
CAS Number	566-17-6
Molecular Formula	C24H40O4
Molecular Weight	392.572
MDL Number	MFCD00036859
SMILES	OC(=O)CC[C@H]([C@H]1CC[C@@H]2[C@]1(C)[C@@H](O)C[C@H]1[C@H]2[C@H](O)C[C@H]2[C@]1(C)CCCC2)C

Isodeoxycholic acid is a versatile compound commonly utilized in chemical synthesis as a key building block. With its unique structure and properties, this acid serves as a crucial intermediate in the production of various pharmaceuticals, bioactive molecules, and functional materials. In chemical synthesis, Isodeoxycholic acid acts as a valuable starting material for the synthesis of complex organic compounds through various reactions such as esterification, amidation, and oxidation. Its presence enables the efficient construction of diverse molecular structures, making it an essential component in the development of novel compounds with potential therapeutic applications. By incorporating Isodeoxycholic acid into synthetic pathways, chemists can access a wide range of molecular scaffolds, facilitating the creation of innovative compounds for pharmaceutical, medical, and materials science research. Its versatility and reactivity make Isodeoxycholic acid a valuable tool for advancing the field of chemical synthesis and discovering new molecules with unique properties and functions.