
Catalog Number	AR00DISV
Chemical Name	(S)-N-Boc-2-(5'-hexenyl)glycine
CAS Number	552335-71-4
Molecular Formula	C13H23NO4
Molecular Weight	257.32601999999997
MDL Number	MFCD03094928
SMILES	C=CCCCC[C@@H](C(=O)O)NC(=O)OC(C)(C)C

(S)-N-Boc-2-(5'-hexenyl)glycine is a versatile building block in chemical synthesis, widely used in the creation of diverse organic compounds. This compound plays a crucial role in the synthesis of various pharmaceuticals, natural products, and other organic molecules. Its unique structure and reactivity make it valuable in the development of complex molecules with specific stereochemical properties. By employing (S)-N-Boc-2-(5'-hexenyl)glycine as a key starting material, chemists can access a wide range of chiral compounds with high efficiency and precision. This compound is particularly useful in the construction of peptide analogs, drug candidates, and bioactive molecules, showcasing its importance in organic synthesis and drug discovery research.