
Catalog Number	AR01PV2X
Chemical Name	1H-Inden-5-amine, 3-(4-aminophenyl)-2,3-dihydro-1,1,3-trimethyl-
CAS Number	54628-90-9
Molecular Formula	C18H22N2
Molecular Weight	266.3807
MDL Number	MFCD00424120
SMILES	Nc1ccc(cc1)C1(C)CC(c2c1cc(N)cc2)(C)C

3-(4-Aminophenyl)-2,3-dihydro-1,1,3-trimethyl-1H-inden-5-amine, also known as $name$, is a versatile compound commonly used in chemical synthesis. In the field of organic chemistry, this compound is employed as a building block in the creation of various complex molecules. Its unique structure and reactivity make it an ideal starting material for the synthesis of pharmaceuticals, agrochemicals, and advanced materials.One key application of 3-(4-Aminophenyl)-2,3-dihydro-1,1,3-trimethyl-1H-inden-5-amine is in the formation of substituted indene derivatives. By functionalizing the amino and methyl groups present in the molecule, chemists can easily introduce a wide range of chemical functionalities to tailor the properties of the final product. This capability is particularly valuable in drug discovery and development, where chemists strive to optimize the biological activity and pharmacokinetic profile of potential drug candidates.Furthermore, the presence of the aromatic ring in 3-(4-Aminophenyl)-2,3-dihydro-1,1,3-trimethyl-1H-inden-5-amine enables it to participate in various aromatic substitution reactions, allowing for further structural diversification. Through strategic synthetic manipulations, chemists can access a plethora of indenyl-based compounds with enhanced properties and functionalities for a myriad of applications in the chemical industry.