
Catalog Number	AR00DFEI
Chemical Name	5Beta-cholanic acid
CAS Number	546-18-9
Molecular Formula	C24H40O2
Molecular Weight	360.5732
MDL Number	MFCD00065904
SMILES	OC(=O)CCC(C1CCC2C1(C)CCC1C2CCC2C1(C)CCCC2)C

5β-Cholanic acid is a key building block in chemical synthesis, commonly used as a starting material for the production of various pharmaceuticals, steroids, and other organic compounds. Its unique structure and reactivity make it an essential precursor in the synthesis of important molecules. One of the primary applications of 5β-Cholanic acid in chemical synthesis is its role in the creation of bile acids, which are crucial for digestion and absorption of fats in the body. Additionally, it serves as a starting material for the synthesis of corticosteroids, hormones that play a vital role in regulating metabolism, immune response, and stress levels. Due to its versatility and significance in organic chemistry, 5β-Cholanic acid is a valuable compound in the arsenal of chemists and researchers working in the field of pharmaceuticals and drug development.