
Catalog Number	AR00DHEU
Chemical Name	2-Propen-1-one, 3-(3,4-dimethoxyphenyl)-1-phenyl-
CAS Number	5416-71-7
Molecular Formula	C17H16O3
Molecular Weight	268.3071
MDL Number	MFCD01705885
SMILES	COc1cc(C=CC(=O)c2ccccc2)ccc1OC

3-(3,4-Dimethoxyphenyl)-1-phenylprop-2-en-1-one, also known as $name$, serves as a versatile building block in chemical synthesis due to its unique structural features and reactivity. This compound is commonly utilized in the synthesis of various important organic molecules through various chemical transformations. One of the key applications of $name$ in chemical synthesis is its role as a key intermediate in the preparation of bioactive compounds, pharmaceuticals, and agrochemicals. Additionally, it can be used as a starting material in the production of functionalized aromatic compounds, which have applications in materials science and medicinal chemistry. Furthermore, the presence of both phenyl and methoxy groups in $name$ provides opportunities for further derivatization and modification, making it a valuable tool for synthetic chemists aiming to access diverse chemical space.