
Catalog Number	AR01FLWP
Chemical Name	3-Methyl-4-nitrobenzenethiol
CAS Number	53827-87-5
Molecular Formula	C7H7NO2S
Molecular Weight	169.201
MDL Number	MFCD22481049
SMILES	Sc1ccc(c(c1)C)[N+](=O)[O-]

3-Methyl-4-nitrobenzenethiol, commonly known as $name$, plays a crucial role in chemical synthesis as a versatile building block in organic chemistry. This compound is utilized primarily as a key intermediate in the synthesis of complex organic molecules due to its unique structure and reactivity. One of the key applications of 3-Methyl-4-nitrobenzenethiol is its involvement in the formation of various sulfur-containing compounds through thiol-disulfide exchange reactions. Additionally, this compound serves as a valuable starting material in the preparation of pharmaceuticals, agrochemicals, and specialty chemicals. Its ability to undergo diverse chemical transformations makes it an essential component in the toolbox of synthetic chemists for the construction of structurally complex and biologically active molecules.