
Catalog Number	AR00DFVE
Chemical Name	2-Phenyl-benzooxazol-6-ylamine
CAS Number	53421-88-8
Molecular Formula	C13H10N2O
Molecular Weight	210.2313
MDL Number	MFCD00092775
SMILES	Nc1ccc2c(c1)oc(n2)c1ccccc1

2-Phenylbenzo[d]oxazol-6-amine is a valuable compound in chemical synthesis, frequently utilized as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials. Its unique structural properties and reactivity make it an essential intermediate in the production of complex organic molecules. This compound plays a crucial role in the development of novel drugs, advanced materials, and specialty chemicals due to its versatility and ability to undergo diverse synthetic transformations. In the realm of medicinal chemistry, 2-Phenylbenzo[d]oxazol-6-amine serves as a crucial precursor for the synthesis of biologically active compounds, aiding researchers in the quest for new therapeutic agents. Additionally, its incorporation in agrochemical synthesis enables the design of innovative pesticides and herbicides with enhanced efficacy. Furthermore, this compound contributes to the creation of functional materials with tailored properties, such as luminescent dyes and polymers. Overall, the versatile application of 2-Phenylbenzo[d]oxazol-6-amine in chemical synthesis highlights its significance in driving innovation across various scientific disciplines.