
Catalog Number	AR00D900
Chemical Name	E,Z-3,13-OCTADECADIENYLACETATE
CAS Number	53120-26-6
Molecular Formula	C20H36O2
Molecular Weight	308.4986
MDL Number	MFCD00798070
SMILES	CCCC/C=CCCCCCCC/C=C/CCCOC(=O)C

(E,Z)-3,13-Octadecadienyl acetate, commonly known as $name$, is a versatile chemical compound widely used in chemical synthesis processes. Its unique molecular structure and reactivity make it a valuable building block in various applications. In chemical synthesis, (E,Z)-3,13-Octadecadienyl acetate is utilized as a key intermediate for the production of fragrances, flavors, and pharmaceutical compounds. Its ability to undergo diverse chemical reactions enables the creation of complex molecular structures, making it indispensable in the synthesis of bioactive molecules and natural products. Additionally, (E,Z)-3,13-Octadecadienyl acetate serves as a precursor for the synthesis of insect pheromones, which are crucial in pest control strategies and agricultural practices. With its significant role in the synthesis of valuable compounds, (E,Z)-3,13-Octadecadienyl acetate plays a fundamental part in advancing chemical research and development across various industries.