
Catalog Number	AR00E3CV
Chemical Name	(2R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-hydroxypropanoic acid
CAS Number	52558-23-3
Molecular Formula	C8H15NO5
Molecular Weight	205.2084
MDL Number	MFCD18970241
SMILES	O[C@@H](C(=O)O)CNC(=O)OC(C)(C)C

The compound (2R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-hydroxypropanoic acid, also known as $name$, is a versatile molecule commonly used in chemical synthesis. Its primary application lies in the field of peptide synthesis, where it serves as a key building block for incorporating specific functionalities into peptide chains.In chemical synthesis, (2R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-hydroxypropanoic acid acts as a protective group for amino groups in peptides. By attaching this compound to the amino group of a particular amino acid residue, chemists can effectively shield the amine functionality from unwanted reactions during peptide assembly. This protection allows for selective deprotection at a later stage, enabling precise control over the sequence and structure of the final peptide product.Furthermore, the hydroxy and carboxylic acid functionalities present in (2R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-hydroxypropanoic acid offer additional points for further modification and functionalization, making it a valuable tool in the synthesis of complex peptide structures with tailored properties.Overall, the strategic incorporation of (2R)-3-[[(1,1-Dimethylethoxy)carbonyl]amino]-2-hydroxypropanoic acid in chemical synthesis processes facilitates the efficient construction of bioactive peptides, pharmaceuticals, and other molecular entities with specific applications in drug discovery, biochemical research, and biotechnology.