
Catalog Number	AR00DUHJ
Chemical Name	2,5-Pyrrolidinedicarboxylic acid, 1-(phenylmethyl)-, diethyl ester,(2R,5S)-rel-
CAS Number	52321-06-9
Molecular Formula	C17H23NO4
Molecular Weight	305.3688
MDL Number	MFCD00830964
SMILES	CCOC(=O)[C@@H]1CC[C@@H](N1Cc1ccccc1)C(=O)OCC

The chiral compound rel-(2R,5S)-Diethyl 1-benzylpyrrolidine-2,5-dicarboxylate is a valuable reagent in chemical synthesis due to its stereochemical properties. This compound can effectively serve as a key building block in the creation of complex organic molecules, particularly in the synthesis of pharmaceutical intermediates and natural product derivatives. The stereochemistry of this compound plays a crucial role in controlling the outcome of various chemical reactions, allowing chemists to selectively generate desired enantiomers or diastereomers in their synthetic routes. Additionally, the presence of the benzyl group in the structure provides a versatile handle for further functionalization, enabling the introduction of a wide range of different chemical groups into the molecule. By leveraging the unique structural features of rel-(2R,5S)-Diethyl 1-benzylpyrrolidine-2,5-dicarboxylate, chemists can access diverse and complex molecules with precise control over their stereochemistry and functional groups.