
Catalog Number	AR01EG55
Chemical Name	Luteolin-3',7-diglucoside hplc
CAS Number	52187-80-1
Molecular Formula	C27H30O16
Molecular Weight	610.5175
MDL Number	MFCD00017467
SMILES	OC[C@H]1O[C@@H](Oc2cc(O)c3c(c2)oc(cc3=O)c2ccc(c(c2)O[C@@H]2O[C@H](CO)[C@H]([C@@H]([C@H]2O)O)O)O)[C@@H]([C@H]([C@@H]1O)O)O

Luteolin 3′,7-diglucoside, a natural compound found in various plants, possesses unique properties that make it a valuable asset in chemical synthesis. This compound can be utilized as a versatile building block in the creation of novel pharmaceuticals, agrochemicals, and other fine chemicals. With its robust chemical structure and reactivity, Luteolin 3′,7-diglucoside serves as a crucial intermediate in the synthesis of complex molecules, enabling chemists to efficiently access a diverse array of chemical entities. By leveraging the capabilities of Luteolin 3′,7-diglucoside, researchers can unlock new possibilities in drug discovery, materials science, and other fields that rely on the precise manipulation of chemical structures.