
Catalog Number	AR00D93G
Chemical Name	2-Piperidin-4-yl-benzooxazole
CAS Number	51784-03-3
Molecular Formula	C12H14N2O
Molecular Weight	202.2524
MDL Number	MFCD01475844
SMILES	N1CCC(CC1)c1nc2c(o1)cccc2

2-(Piperidin-4-yl)benzo[d]oxazole is a versatile compound commonly used in chemical synthesis as a key building block in the creation of various pharmaceuticals, agrochemicals, and materials. Its unique structure incorporates both a piperidine ring and an oxazole ring, offering a range of reactivity and functionality that enables its application in a multitude of synthetic pathways. In organic synthesis, 2-(Piperidin-4-yl)benzo[d]oxazole serves as a valuable intermediate for the construction of complex molecules through processes such as nucleophilic substitution, cross-coupling reactions, and cyclization. Its presence in the molecular design of target compounds imparts desirable pharmacological or physical properties, making it a valuable tool for medicinal chemists, material scientists, and chemical researchers alike.