
Catalog Number	AR00DBZF
Chemical Name	Adenosine,N-benzoyl-2'-deoxy-3'-o-[(1,1-dimethylethyl)dimethylsilyl]-
CAS Number	51549-40-7
Molecular Formula	C23H31N5O4Si
Molecular Weight	469.6088
MDL Number	MFCD29918154
SMILES	OC[C@H]1O[C@H](C[C@@H]1O[Si](C(C)(C)C)(C)C)n1cnc2c1ncnc2NC(=O)c1ccccc1

N-Benzoyl-2'-deoxy-3'-O-[(1,1-dimethylethyl)dimethylsilyl]-Adenosine is a versatile compound widely used in chemical synthesis due to its unique properties. This compound serves as a crucial building block in the synthesis of nucleoside analogs, which are vital in drug development and medicinal chemistry. By incorporating N-Benzoyl-2'-deoxy-3'-O-[(1,1-dimethylethyl)dimethylsilyl]-Adenosine into the molecular structure of nucleoside analogs, researchers can modify their physicochemical properties for enhanced bioactivity and pharmacokinetics. This compound plays a pivotal role in creating novel pharmaceuticals, agrochemicals, and molecular probes with tailored functionalities, making it an indispensable tool in organic synthesis and drug discovery.