
Catalog Number	AR01E8UR
Chemical Name	1,4-b-D-Mannotetraose
CAS Number	51327-76-5
Molecular Formula	C24H42O21
Molecular Weight	666.5777
MDL Number	MFCD00071593
SMILES	OC[C@H]([C@H]([C@@H]([C@@H](C=O)O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@@H]1O)O)O[C@@H]1O[C@H](CO)[C@H]([C@@H]([C@@H]1O)O)O)O

Mannotetraose, a complex carbohydrate molecule composed of four mannose units linked together, plays a crucial role in chemical synthesis as a versatile building block. In the field of organic chemistry, mannotetraose serves as a valuable precursor for the synthesis of various biologically significant compounds. Its unique structure and reactivity make it a valuable tool for designing and creating new molecules with specific properties and functions. By strategically incorporating mannotetraose into synthetic pathways, chemists can access a wide range of structurally diverse compounds that can be used in pharmaceuticals, materials science, and other industries. Additionally, the ability to modify different positions on the mannotetraose backbone allows for fine-tuning of the resulting molecules, enabling researchers to tailor their properties for specific applications. Overall, mannotetraose is a versatile and powerful building block in chemical synthesis, opening up exciting possibilities for creating novel compounds with high potential for various industrial and research purposes.