
Catalog Number	AR00DCHD
Chemical Name	1-(5-Aminopentyl)-1H-pyrrole-2,5-dione dihydrochloride
CAS Number	510709-83-8
Molecular Formula	C9H16Cl2N2O2
Molecular Weight	255.14154000000002
MDL Number	MFCD11519192
SMILES	NCCCCCN1C(=O)C=CC1=O.Cl.Cl

1-(5-Aminopentyl)-1H-pyrrole-2,5-dione hydrochloride is a versatile compound widely used in chemical synthesis due to its unique properties. In organic chemistry, it serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and specialty chemicals. Its reactive amino and carbonyl functional groups enable it to participate in a range of synthetic reactions, including condensation, alkylation, and cyclization processes. This compound plays a crucial role in the development of novel molecules and the modification of existing chemical structures, making it an essential building block in the synthesis of diverse organic compounds.