
Catalog Number	AR00DM1G
Chemical Name	4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)aniline
CAS Number	508223-55-0
Molecular Formula	C13H17BF3NO2
Molecular Weight	287.0858
MDL Number	MFCD16996231
SMILES	Nc1ccc(cc1C(F)(F)F)B1OC(C(O1)(C)C)(C)C

4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzenamine is a versatile compound widely utilized in chemical synthesis. Its unique structure allows for efficient incorporation of both boron and fluorine functionalities into target molecules. In organic synthesis, this compound serves as a valuable building block for the preparation of various pharmaceuticals, agrochemicals, and advanced materials. Specifically, it acts as a key reagent in Suzuki coupling reactions, enabling the introduction of the trifluoromethyl group into organic frameworks with high efficiency and selectivity. Additionally, the boron moiety in this compound facilitates further derivatization through diverse transformations such as Suzuki-Miyaura cross-coupling, metal-catalyzed borylation, and C-H activation. Overall, the strategic design of 4-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-2-(trifluoromethyl)benzenamine makes it a valuable tool for synthetic chemists seeking to construct complex molecular architectures with enhanced properties and functionalities.