
Catalog Number	AR01KWHP
Chemical Name	2-(6-Bromo-2,3-dihydro-3-oxo-1H-inden-1-ylidene)propanedinitrile
CAS Number	507484-47-1
Molecular Formula	C12H5BrN2O
Molecular Weight	273.0849
MDL Number	MFCD31699449
SMILES	N#C/C(=C\1/CC(=O)c2c1cc(Br)cc2)/C#N

2-(6-Bromo-2,3-dihydro-3-oxo-1H-inden-1-ylidene)propanedinitrile is a valuable compound in chemical synthesis, particularly in the field of organic chemistry. This compound serves as a versatile building block that enables the creation of a wide range of more complex molecules through various chemical reactions.One common application of 2-(6-Bromo-2,3-dihydro-3-oxo-1H-inden-1-ylidene)propanedinitrile is in the synthesis of heterocyclic compounds. By utilizing the reactive functional groups present in this compound, chemists can introduce different substituents and modify the structure to generate diverse heterocycles with specific properties and functions.Additionally, 2-(6-Bromo-2,3-dihydro-3-oxo-1H-inden-1-ylidene)propanedinitrile is used as a key intermediate in the production of pharmaceuticals, agrochemicals, and materials with advanced functionalities. Its unique molecular structure and reactivity make it an essential tool for designing and synthesizing molecules with desirable characteristics for various applications.Overall, the strategic incorporation of 2-(6-Bromo-2,3-dihydro-3-oxo-1H-inden-1-ylidene)propanedinitrile in chemical synthesis enables the efficient and controlled construction of complex organic molecules, advancing research and innovation in the field of chemistry.