
Catalog Number	AR00DLXE
Chemical Name	4-Nitrophenylboronic acid neopentylglycol ester
CAS Number	502622-85-7
Molecular Formula	C11H14BNO4
Molecular Weight	235.04415999999998
MDL Number	MFCD03701688
SMILES	CC1(C)COB(OC1)c1ccc(cc1)[N+](=O)[O-]

5,5-Dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane, also known as $name$, is a versatile compound widely used in chemical synthesis. This compound serves as a valuable building block in the formation of various organic molecules due to its unique structural properties.One of the key applications of $name$ in chemical synthesis is its use as a boron-containing reagent in Suzuki-Miyaura cross-coupling reactions. This reaction is an important tool in organic chemistry for the formation of carbon-carbon bonds. By utilizing $name$ in this reaction, chemists can efficiently synthesize complex organic molecules with high selectivity and efficiency.Additionally, $name$ can also be employed in the synthesis of pharmaceuticals, agrochemicals, and materials science applications. Its compatibility with a wide range of functional groups makes it a valuable tool for chemists seeking to introduce the 4-nitrophenyl moiety into their target molecules.Overall, the unique structure and reactivity of 5,5-Dimethyl-2-(4-nitrophenyl)-1,3,2-dioxaborinane make it an essential building block in modern organic synthesis, enabling chemists to access a diverse array of complex molecules for various applications.