
Catalog Number	AR00DLOZ
Chemical Name	2-(4,4,5,5-Tetramethyl-1,3,2-dioxaborolan-2-yl)-1-cyclohexene-1-carboxylic acid ethyl ester
CAS Number	497959-39-4
Molecular Formula	C15H25BO4
Molecular Weight	280.1676
MDL Number	MFCD11520539
SMILES	CCOC(=O)C1=C(CCCC1)B1OC(C(O1)(C)C)(C)C

Ethyl 2-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)cyclohex-1-enecarboxylate is a versatile compound widely utilized in chemical synthesis, particularly in the field of organic chemistry. Its unique structure containing a boronate ester moiety makes it a valuable building block for constructing complex molecules through various reactions like Suzuki-Miyaura coupling. This compound serves as a key intermediate in the synthesis of pharmaceuticals, agrochemicals, and materials with specific properties, demonstrating its significance in designing new compounds with tailored functions. Its reactivity and compatibility with a variety of functional groups make it a valuable tool for organic chemists seeking efficient routes to target molecules.