
Catalog Number	AR00DT2A
Chemical Name	4H-Benzo[a]quinolizine,3-ethyl-1,6,7,11b-tetrahydro-9,10-dimethoxy-2-[[(1R)-1,2,3,4-tetrahydro-6,7-dimethoxy-1-isoquinolinyl]methyl]-, (11bS)-
CAS Number	4914-30-1
Molecular Formula	C29H38N2O4
Molecular Weight	478.623
MDL Number	MFCD01729551
SMILES	CCC1=C(C[C@H]2NCCc3c2cc(OC)c(c3)OC)C[C@@H]2N(C1)CCc1c2cc(c(c1)OC)OC

Dehydroemetine, a potent derivative of emetine, finds significant application in chemical synthesis as a versatile reagent due to its unique structural properties. In organic chemistry, Dehydroemetine is utilized as a key intermediate in the synthesis of complex molecules and natural products. It exhibits strong potential as a building block for the construction of various pharmacologically active compounds.In particular, Dehydroemetine serves as a valuable starting material for the creation of novel drugs and pharmaceuticals. Its reactivity allows chemists to introduce specific functional groups and modify molecular structures with precision, enabling the design of targeted therapeutic agents. Additionally, Dehydroemetine's versatile nature makes it a valuable tool in the synthesis of specialized materials and bioactive molecules for research and development purposes.Furthermore, the use of Dehydroemetine in chemical synthesis contributes to the advancement of medicinal chemistry and drug discovery efforts. Its ability to undergo selective transformations under mild reaction conditions makes it a valuable component in the creation of diverse chemical entities with potential therapeutic benefits. Overall, Dehydroemetine plays a crucial role in the development of innovative synthetic methodologies and the synthesis of biologically relevant compounds with promising applications in various fields.