
Catalog Number	AR00DEV8
Chemical Name	Daphnin
CAS Number	486-55-5
Molecular Formula	C15H16O9
Molecular Weight	340.2821
MDL Number	MFCD28053406
SMILES	OC[C@H]1OC(Oc2ccc3c(c2O)oc(=O)cc3)[C@@H]([C@H]([C@@H]1O)O)O

Daphnin, a naturally occurring compound found in certain plants, serves as a valuable tool in chemical synthesis due to its unique reactivity and structural properties. In organic chemistry, Daphnin can be utilized as a starting material or reagent in various reactions to afford a wide range of chemical products. Its aromatic structure and functional groups make Daphnin versatile for applications in synthesis, such as in the formation of heterocycles, aromatic compounds, or as a chiral building block. Additionally, its reactivity towards certain reagents can lead to the selective formation of specific chemical bonds, enabling chemists to control the outcome of a reaction. Overall, Daphnin plays a crucial role in the field of chemical synthesis, offering opportunities for the creation of new molecules and the exploration of novel reaction pathways.