
Catalog Number	AR00D9S2
Chemical Name	1-(2-HYDROXYETHYL)-2-HYDROXYMETHYL-5-NITROIMIDAZOLE
CAS Number	4812-40-2
Molecular Formula	C6H9N3O4
Molecular Weight	187.15336
MDL Number	MFCD01721480
SMILES	OCCn1c(CO)ncc1[N+](=O)[O-]

2-(2-(Hydroxymethyl)-5-nitro-1H-imidazol-1-yl)ethanol is a versatile compound widely used in chemical synthesis, particularly in the pharmaceutical industry. Its unique structure containing both a nitro group and an imidazole ring allows for a variety of reactions and applications. In chemical synthesis, this compound serves as a key building block for the creation of novel drug molecules, by participating in reactions that form important functional groups or modify existing structures. Its hydroxymethyl group provides a reactive site for further derivatization, allowing for the introduction of various substituents to tailor the compound's properties. Additionally, the presence of the imidazole ring confers biological activity to the synthesized molecules, making this compound crucial for the development of new pharmaceuticals with potential therapeutic applications.