
Catalog Number	AR00DL7T
Chemical Name	N1-[(1S,2R,4S)-2-Amino-4-[(dimethylamino)carbonyl]cyclohexyl]-N2-(5-chloro-2-pyridinyl)ethanediamide
CAS Number	480452-37-7
Molecular Formula	C16H22ClN5O3
Molecular Weight	367.83058
MDL Number	MFCD30747786
SMILES	N[C@@H]1C[C@H](CC[C@@H]1NC(=O)C(=O)Nc1ccc(cn1)Cl)C(=O)N(C)C

The compound N1-[(1S,2R,4S)-2-Amino-4-[(dimethylamino)carbonyl]cyclohexyl]-N2-(5-chloro-2-pyridinyl)ethanediamide is commonly utilized in chemical synthesis processes. It serves as a versatile building block due to its unique structural features, allowing for the creation of complex organic molecules with specific functionalities. By incorporating this compound into reaction pathways, chemists can tailor the synthesis of various compounds for applications in pharmaceuticals, agrochemicals, materials science, and more.