
Catalog Number	AR01FGNC
Chemical Name	N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]Cyclohexanecarboxamide
CAS Number	2246818-94-8
Molecular Formula	C19H28BNO3
Molecular Weight	329.2415
MDL Number	MFCD14585588
SMILES	O=C(C1CCCCC1)Nc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

N-[4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl]Cyclohexanecarboxamide is a versatile compound widely utilized in chemical synthesis as a key building block. Its unique structure allows it to participate in various reactions, making it an essential component in the creation of complex organic molecules. This compound is particularly valuable in the formation of pharmaceutical intermediates, agrochemicals, and functional materials due to its ability to introduce specific functionalities and stereochemistries into the target molecules. Additionally, its compatibility with a range of synthetic methodologies enhances its utility in the development of novel compounds with diverse applications.