
Catalog Number	AR001T2U
Chemical Name	1,3,2-Dioxaborolane-4,5-dicarboxamide, 2-butyl-N4,N4,N5,N5-tetramethyl-, (4S,5S)-
CAS Number	161344-84-9
Molecular Formula	C12H23BN2O4
Molecular Weight	270.133
MDL Number	MFCD05663838
SMILES	CCCCB1O[C@@H]([C@H](O1)C(=O)N(C)C)C(=O)N(C)C

The compound 2-Butyl-1,3,2-dioxaborolane-4s,5s-dicarboxylic acid bis(dimethylamide) plays a crucial role in chemical synthesis due to its unique properties and reactivity. It serves as a versatile building block in organic chemistry, particularly in the formation of complex organic molecules. This compound is commonly used as a reagent in organic transformations, such as Suzuki-Miyaura cross-coupling reactions, which are vital in the synthesis of pharmaceuticals, agrochemicals, and materials science. Its boronic acid functionality allows for the formation of stable boron-carbon bonds, making it a valuable tool for carbon-carbon bond formation in the construction of various organic frameworks. Furthermore, the presence of the dimethylamide moiety enhances the solubility and stability of the compound in various reaction conditions, expanding its utility in diverse synthetic procedures.

1,3,2-Dioxaborolane-4,5-dicarboxamide, 2-butyl-N4,N4,N5,N5-tetramethyl-, (4S,5S)-

161344-84-9

Product Details