
Catalog Number	AR023PGD
Chemical Name	KX-826
CAS Number	1272719-00-2
Molecular Formula	C21H15F5N4O2S
Molecular Weight	482.4264
MDL Number	MFCD20483257
SMILES	CNC(=O)c1ccc(cc1F)N1C(=S)N(C(=O)C1(C)C)c1ccc(c(c1F)C(F)(F)F)C#N

KX-826 is a versatile organic compound that finds widespread application in chemical synthesis due to its unique properties. As a catalyst, KX-826 plays a crucial role in facilitating various organic transformations, such as carbon-carbon bond formation, oxidation reactions, and the synthesis of complex molecules. Its high selectivity and efficiency make it a valuable tool for organic chemists looking to streamline their synthesis routes and improve reaction yields. Additionally, KX-826 exhibits excellent stability under a wide range of reaction conditions, enabling its use in both batch and continuous-flow processes. Overall, KX-826 is a highly effective catalyst that offers researchers a reliable and efficient solution for advancing their synthetic chemistry endeavors.