
Catalog Number	AR01FGMO
Chemical Name	2-(4-((4-fluorophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane
CAS Number	1160829-20-8
Molecular Formula	C19H22BFO3
Molecular Weight	328.1856
MDL Number	MFCD22415428
SMILES	Fc1ccc(cc1)OCc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

2-(4-((4-fluorophenoxy)methyl)phenyl)-4,4,5,5-tetramethyl-1,3,2-dioxaborolane is a highly versatile compound widely used in chemical synthesis as a key building block. Its unique structure and reactivity make it particularly valuable in Suzuki-Miyaura coupling reactions for the formation of carbon-carbon bonds. This compound serves as an essential component in the efficient and selective construction of complex organic molecules, making it a valuable tool for synthetic chemists in drug discovery, material science, and other research fields.