
Catalog Number	AR009681
Chemical Name	1-(4-morpholinyl)-2-[4-(4，4，5，5-tetramethyl-1，3，2-dioxaborolan-2-yl)phenyl]-Ethanone
CAS Number	1092563-23-9
Molecular Formula	C18H26BNO4
Molecular Weight	331.2143399999999
MDL Number	MFCD18910277
SMILES	O=C(N1CCOCC1)Cc1ccc(cc1)B1OC(C(O1)(C)C)(C)C

1-morpholino-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanone is a versatile compound widely used in chemical synthesis processes. This compound serves as a key building block in the development of various organic molecules due to its unique structure and reactivity. Specifically, it can be employed in the formation of complex organic compounds through Suzuki-Miyaura cross-coupling reactions. By acting as a boron-containing electrophile in these reactions, 1-morpholino-2-(4-(4,4,5,5-tetramethyl-1,3,2-dioxaborolan-2-yl)phenyl)ethanone facilitates the formation of carbon-carbon bonds, allowing for the synthesis of a diverse range of organic compounds with high efficiency and selectivity. Additionally, the presence of the morpholino group in the molecule enhances the stability and solubility of the compound, making it a valuable tool in modern organic synthesis strategies.