
Catalog Number	AR01JX2K
Chemical Name	4-Benzoxazolecarboxylic acid, 2-(2-hydroxyphenyl)-
CAS Number	906095-21-4
Molecular Formula	C14H9NO4
Molecular Weight	255.2256
MDL Number	MFCD28971005
SMILES	Oc1ccccc1c1oc2c(n1)c(ccc2)C(=O)O

4-Benzoxazolecarboxylic acid, 2-(2-hydroxyphenyl)- is a versatile compound often utilized in chemical synthesis as a key building block in the production of various pharmaceuticals and fine chemicals. Its unique structure and properties make it a valuable tool in the creation of novel molecules with potential biological activities. In organic synthesis, this compound can serve as a starting material for the preparation of heterocyclic structures or as a precursor for the synthesis of more complex molecules through various chemical reactions such as esterification, amidation, or Suzuki coupling reactions. Its presence in a synthetic pathway can enable the introduction of specific functional groups or provide a point of diversification to generate a library of compounds for drug discovery or material science applications.