
Catalog Number	AR00H9JC
Chemical Name	Starch, 2-hydroxyethyl ether
CAS Number	9005-27-0
Molecular Formula	C22H44O17
Molecular Weight	580.57456
MDL Number	MFCD00131356
SMILES	OC[C@H]1O[C@H](O)[C@@H]([C@H]([C@@H]1O)O)O.OCCOC[C@H]1O[C@H](OCCO)[C@@H]([C@H]([C@@H]1OCCO)OCCO)OCCO

Hydroxyethyl starch, also known as HES, is a versatile polymer widely utilized in chemical synthesis for various applications. Due to its unique properties, HES plays a crucial role in catalyzing reactions, enhancing reaction efficiency, and controlling the molecular weight distribution of products. In chemical synthesis, HES acts as a stabilizer and a phase transfer catalyst, facilitating the transfer of reactants between different phases and promoting the formation of desired products. Additionally, HES can also serve as a template in synthesis processes, guiding the arrangement of molecules to achieve specific structures or functions. Its solubility in a wide range of solvents makes it a valuable tool in optimizing reaction conditions and improving the overall yield of the products. Furthermore, the biocompatibility and low toxicity of HES make it a preferred choice for various chemical synthesis applications where purity and safety are essential considerations.