
Catalog Number	AR0036Z6
Chemical Name	4-[4-(Dimethylamino)phenyl]-1,2,4-triazolidine-3,5-dione
CAS Number	883455-55-8
Molecular Formula	C10H12N4O2
Molecular Weight	220.2279
MDL Number	MFCD11655892
SMILES	CN(c1ccc(cc1)n1c(=O)[nH][nH]c1=O)C

4-[4-(Dimethylamino)phenyl]-1,2,4-triazolidine-3,5-dione is a versatile compound widely employed in chemical synthesis due to its unique properties and reactivity. This compound serves as a key building block in organic chemistry, particularly in the development of novel pharmaceuticals and agrochemicals. Its ability to undergo various functional group transformations makes it a valuable tool for synthesizing complex molecules with specific biological activities. Additionally, 4-[4-(Dimethylamino)phenyl]-1,2,4-triazolidine-3,5-dione plays a crucial role in the creation of molecular probes for biological studies and in the preparation of specialized materials for research and industrial applications. Its versatility and synthetic utility make it a valuable asset in the toolkit of organic chemists aiming to design and synthesize cutting-edge molecules with diverse functionalities.