
Catalog Number	AR005FQR
Chemical Name	Benzene,1,2,3,4,5-pentafluoro-6-(trichloromethyl)-
CAS Number	778-34-7
Molecular Formula	C7Cl3F5
Molecular Weight	285.4259
MDL Number	MFCD01013630
SMILES	Fc1c(F)c(F)c(c(c1F)C(Cl)(Cl)Cl)F

Benzene, 1,2,3,4,5-pentafluoro-6-(trichloromethyl)- is a versatile compound widely utilized in chemical synthesis as a key building block for various organic reactions. With its unique structure featuring both fluorine and trichloromethyl groups, this compound plays a crucial role in the creation of complex organic molecules in the laboratory setting. Its incorporation in synthesis processes enables chemists to introduce specific functional groups with high precision, leading to the development of novel pharmaceuticals, agrochemicals, and advanced materials. In addition, Benzene, 1,2,3,4,5-pentafluoro-6-(trichloromethyl)- facilitates the synthesis of specialty chemicals and fine chemicals through controlled reactions, making it an indispensable tool for organic chemists seeking to expand the frontiers of chemical innovation.