
Catalog Number	AR00G7J0
Chemical Name	Carboxyatractyloside
CAS Number	77228-71-8
Molecular Formula	C31H46O18S2
Molecular Weight	770.8161
MDL Number	MFCD00152201
SMILES	OCC1OC(OC2CC(C(=O)O)(C(=O)O)C3C(C2)(C)C2CCC4CC2(CC3)C(O)C4=C)C(C(C1OS(=O)(=O)O)OS(=O)(=O)O)OC(=O)CC(C)C

Carboxyatractyloside, a naturally occurring compound found in certain plants, possesses the unique ability to inhibit the mitochondrial ADP/ATP carrier protein. This mechanism of action makes it a valuable tool in chemical synthesis, particularly in studies related to membrane transport and bioenergetics. By utilizing carboxyatractyloside, researchers can selectively inhibit mitochondrial ATP transport and study the resulting effects on cellular processes, thereby uncovering insights into the role of ATP transport in biochemical pathways. Furthermore, its specific targeting mechanism allows for precise modulation of mitochondrial function, making carboxyatractyloside a versatile and specialized reagent in the field of chemical synthesis.