
Catalog Number	AR00G45H
Chemical Name	4-BROMOBENZONITRILE-D4
CAS Number	771534-56-6
Molecular Formula	C7BrD4N
Molecular Weight	186.042
MDL Number	MFCD08704924
SMILES	c1([2H])c(C#N)c([2H])c(c(c1[2H])Br)[2H]

Benzonitrile-2,3,5,6-d4, 4-bromo- (9CI) is a versatile compound that finds significant application in chemical synthesis processes. This compound serves as a crucial building block in the creation of various complex organic molecules through both traditional and modern synthetic methodologies. With its unique isotopic labeling pattern, Benzonitrile-2,3,5,6-d4, 4-bromo- (9CI) plays a crucial role in tracing reaction mechanisms and understanding molecular transformations, particularly in the field of organic chemistry research. By incorporating this compound into the synthesis of target molecules, chemists can gain valuable insights into the pathways and intermediates involved in the formation of intricate organic structures. Additionally, the presence of both deuterium and bromine isotopes in this compound allows for precise characterization and analysis using advanced spectroscopic techniques, aiding in the elucidation of molecular structures and reactivity. In summary, Benzonitrile-2,3,5,6-d4, 4-bromo- (9CI) serves as a valuable tool for chemists engaged in the synthesis and study of complex organic compounds, facilitating a deeper understanding of chemical reactions and mechanisms.