
Catalog Number	AR005QW9
Chemical Name	Methyl 4-hydroxy-1H-indole-6-carboxylate
CAS Number	77140-48-8
Molecular Formula	C10H9NO3
Molecular Weight	191.1834
MDL Number	MFCD04973985
SMILES	COC(=O)c1cc(O)c2c(c1)[nH]cc2

Methyl 4-hydroxy-1H-indole-6-carboxylate is a valuable compound in chemical synthesis due to its significant role as a versatile building block in organic chemistry. This molecule serves as a key intermediate in the production of various pharmaceuticals, agrochemicals, and fine chemicals. By utilizing Methyl 4-hydroxy-1H-indole-6-carboxylate in chemical reactions, researchers can access a wide range of functional derivatives with diverse applications.In chemical synthesis, this compound can undergo various transformation reactions such as esterification, amidation, and cyclization to introduce different functional groups and create new compounds with tailored properties. Its unique structure and reactivity make it an essential component in the construction of complex molecular structures, making it an indispensable tool for organic chemists.Furthermore, Methyl 4-hydroxy-1H-indole-6-carboxylate offers excellent compatibility with a variety of reagents and reaction conditions, allowing for efficient and selective transformations to yield desired products. Its application extends to the synthesis of natural products, pharmaceutical intermediates, and specialty chemicals, highlighting its significance in the field of organic synthesis.