
Catalog Number	AR00G3FO
Chemical Name	24(S),25-Epoxycholesterol (not deuterated)
CAS Number	77058-74-3
Molecular Formula	C27H44O2
Molecular Weight	400.6371
MDL Number	MFCD03695562
SMILES	OC1CCC2(C(=CCC3C2CCC2(C3CCC2C(CCC2OC2(C)C)C)C)C1)C

The compound ($name$) has a key role in chemical synthesis as a chiral building block. Its specific stereochemistry and functional groups make it a valuable intermediate in the creation of intricate organic molecules. By utilizing the unique structural features of ($name$), chemists can efficiently introduce complexity and diversity into target compounds through strategic bond formations and transformations. This compound serves as a versatile tool for the construction of complex molecular architectures in synthetic chemistry processes, enabling the development of novel materials, pharmaceuticals, and bioactive compounds with tailored properties and functionalities.