
Catalog Number	AR0057YS
Chemical Name	β-Estradiol 17-hemisuccinate
CAS Number	7698-93-3
Molecular Formula	C22H28O5
Molecular Weight	372.4547
MDL Number	MFCD00056186
SMILES	OC(=O)CCC(=O)O[C@H]1CC[C@@H]2[C@]1(C)CC[C@H]1[C@H]2CCc2c1ccc(c2)O

Estradiol hemisuccinate is a versatile compound widely utilized in the field of chemical synthesis. As a derivative of estradiol, a natural estrogen hormone, estradiol hemisuccinate plays a crucial role in the development of pharmaceuticals, particularly in the synthesis of estrogen-based medications. This compound serves as a key intermediate in the production of various pharmaceutical products, including hormone replacement therapies and treatments for menopausal symptoms. Through its involvement in chemical synthesis, estradiol hemisuccinate enables the creation of targeted and effective pharmaceutical formulations that address hormonal imbalances and related medical conditions. In addition to its pharmaceutical applications, this compound is also utilized in research settings for studying hormone receptors and mechanisms of estrogen action. With its significant contributions to the field of chemical synthesis, estradiol hemisuccinate remains a valuable component in the development of hormone-based medications and biomedical research.